C21H23N6O8P — CID 174193067
(2R)-2-amino-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]propanoic acid (PubChem CID 174193067) has the molecular formula C21H23N6O8P and a molecular weight of 518.42 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]propanoic acid |
|---|---|
| PubChem CID | 174193067 |
| Molecular Formula | C21H23N6O8P |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | (2R)-2-amino-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]propanoic acid |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COP(=O)(C[C@H](N)C(=O)O)Oc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H23N6O8P/c22-10-21(16-7-6-14-19(24)25-11-26-27(14)16)18(29)17(28)15(34-21)8-33-36(32,9-13(23)20(30)31)35-12-4-2-1-3-5-12/h1-7,11,13,15,17-18,28-29H,8-9,23H2,(H,30,31)(H2,24,25,26)/t13-,15+,17+,18+,21-,36?/m0/s1 |
| InChIKey | CELDQOJCTJZRIR-OFLVSFCCSA-N |
| XLogP | -0.15 |
| TPSA | 228.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|