C29H37N4O8P — CID 157312853
2-ethylbutyl (2R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 157312853) has the molecular formula C29H37N4O8P and a molecular weight of 600.61 g/mol. Its IUPAC name is 2-ethylbutyl (2R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | 2-ethylbutyl (2R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 157312853 |
| Molecular Formula | C29H37N4O8P |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 2-ethylbutyl (2R)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | CCC(CC)COC(=O)[C@@H](C)CP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ccnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C29H37N4O8P/c1-4-20(5-2)15-38-28(36)19(3)17-42(37,41-21-9-7-6-8-10-21)39-16-24-26(34)27(35)29(18-30,40-24)25-12-11-23-22(31)13-14-32-33(23)25/h6-14,19-20,24,26-27,34-35H,4-5,15-17,31H2,1-3H3/t19-,24+,26+,27+,29-,42?/m0/s1 |
| InChIKey | ATXAXOFSFQELLF-AXNKDEQCSA-N |
| XLogP | 3.66 |
| TPSA | 178.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|