C25H29N4O8P — CID 158201774
ethyl (2S)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate (PubChem CID 158201774) has the molecular formula C25H29N4O8P and a molecular weight of 544.50 g/mol. Its IUPAC name is ethyl (2S)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate.
| Compound Name | ethyl (2S)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 158201774 |
| Molecular Formula | C25H29N4O8P |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | ethyl (2S)-3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]-2-methylpropanoate |
| SMILES | CCOC(=O)[C@H](C)C[P@](=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ccnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H29N4O8P/c1-3-34-24(32)16(2)14-38(33,37-17-7-5-4-6-8-17)35-13-20-22(30)23(31)25(15-26,36-20)21-10-9-19-18(27)11-12-28-29(19)21/h4-12,16,20,22-23,30-31H,3,13-14,27H2,1-2H3/t16-,20-,22-,23-,25+,38+/m1/s1 |
| InChIKey | PAYRYCZBMCEQFZ-STWOQGRDSA-N |
| XLogP | 2.24 |
| TPSA | 178.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|