C27H34N5O9P — CID 169312956
[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxymethyl 2-propylpentanoate (PubChem CID 169312956) has the molecular formula C27H34N5O9P and a molecular weight of 603.57 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxymethyl 2-propylpentanoate.
| Compound Name | [[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxymethyl 2-propylpentanoate |
|---|---|
| PubChem CID | 169312956 |
| Molecular Formula | C27H34N5O9P |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxymethyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCOP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H34N5O9P/c1-3-8-18(9-4-2)26(35)37-17-39-42(36,41-19-10-6-5-7-11-19)38-14-21-23(33)24(34)27(15-28,40-21)22-13-12-20-25(29)30-16-31-32(20)22/h5-7,10-13,16,18,21,23-24,33-34H,3-4,8-9,14,17H2,1-2H3,(H2,29,30,31)/t21-,23-,24-,27+,42?/m1/s1 |
| InChIKey | SNKVICCHINUHBF-WODXELPVSA-N |
| XLogP | 3.09 |
| TPSA | 200.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|