C27H31FN5O7P — CID 58039294
ethyl (2S)-1-[[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]pyrrolidine-2-carboxylate (PubChem CID 58039294) has the molecular formula C27H31FN5O7P and a molecular weight of 587.55 g/mol. Its IUPAC name is ethyl (2S)-1-[[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58039294 |
| Molecular Formula | C27H31FN5O7P |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | ethyl (2S)-1-[[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1P(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(C)ncnn23)[C@](C)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H31FN5O7P/c1-4-37-25(35)21-11-8-14-32(21)41(36,40-19-9-6-5-7-10-19)38-15-22-24(34)26(3,28)27(16-29,39-22)23-13-12-20-18(2)30-17-31-33(20)23/h5-7,9-10,12-13,17,21-22,24,34H,4,8,11,14-15H2,1-3H3/t21-,22+,24+,26+,27-,41?/m0/s1 |
| InChIKey | JJPWVBQPWGDPTP-YVHVYDCXSA-N |
| XLogP | 3.48 |
| TPSA | 148.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|