C23H31FN5O12P — CID 58039236
[[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate (PubChem CID 58039236) has the molecular formula C23H31FN5O12P and a molecular weight of 619.50 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate.
| Compound Name | [[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 58039236 |
| Molecular Formula | C23H31FN5O12P |
| Molecular Weight | 619.50 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-cyano-4-fluoro-3-hydroxy-4-methyl-5-(4-methylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
| SMILES | Cc1ncnn2c([C@]3(C#N)O[C@H](COP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C)[C@@H](O)[C@@]3(C)F)cnc12 |
| InChI | InChI=1S/C23H31FN5O12P/c1-13(2)39-20(31)34-11-37-42(33,38-12-35-21(32)40-14(3)4)36-8-16-18(30)22(6,24)23(9-25,41-16)17-7-26-19-15(5)27-10-28-29(17)19/h7,10,13-14,16,18,30H,8,11-12H2,1-6H3/t16-,18-,22-,23+/m1/s1 |
| InChIKey | HXFUWEPFYVBPSJ-ZDZLMVPKSA-N |
| XLogP | 2.84 |
| TPSA | 212.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|