C22H23Cl2N6O6P — CID 158516980
(2R,4S,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3,3-dichloro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile (PubChem CID 158516980) has the molecular formula C22H23Cl2N6O6P and a molecular weight of 569.34 g/mol. Its IUPAC name is (2R,4S,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3,3-dichloro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile.
| Compound Name | (2R,4S,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3,3-dichloro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 158516980 |
| Molecular Formula | C22H23Cl2N6O6P |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | (2R,4S,5R)-2-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3,3-dichloro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile |
| SMILES | CC(=O)[C@H](C)CP(=O)(OC[C@H]1O[C@@](C#N)(c2cnc3c(N)ncnn23)C(Cl)(Cl)[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H23Cl2N6O6P/c1-13(14(2)31)10-37(33,36-15-6-4-3-5-7-15)34-9-16-18(32)22(23,24)21(11-25,35-16)17-8-27-20-19(26)28-12-29-30(17)20/h3-8,12-13,16,18,32H,9-10H2,1-2H3,(H2,26,28,29)/t13-,16-,18+,21+,37?/m1/s1 |
| InChIKey | SNVFSHZFAAINFV-SIBIPTLYSA-N |
| XLogP | 2.87 |
| TPSA | 174.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|