C23H26ClFN7O7P — CID 166015818
propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015818) has the molecular formula C23H26ClFN7O7P and a molecular weight of 597.93 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015818 |
| Molecular Formula | C23H26ClFN7O7P |
| Molecular Weight | 597.93 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)N[P@](=O)(OC[C@H]1O[C@@](C#N)(n2ncc3c(N)ncnc32)[C@@](F)(Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H26ClFN7O7P/c1-13(2)37-21(34)14(3)31-40(35,39-15-7-5-4-6-8-15)36-10-17-18(33)23(24,25)22(11-26,38-17)32-20-16(9-30-32)19(27)28-12-29-20/h4-9,12-14,17-18,33H,10H2,1-3H3,(H,31,35)(H2,27,28,29)/t14?,17-,18-,22-,23-,40+/m1/s1 |
| InChIKey | RMPNMFVATLGMNZ-WACLONQFSA-N |
| XLogP | 2.38 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.93 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|