C23H27ClN7O7P — CID 170126039
propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170126039) has the molecular formula C23H27ClN7O7P and a molecular weight of 579.94 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170126039 |
| Molecular Formula | C23H27ClN7O7P |
| Molecular Weight | 579.94 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4S,5R)-5-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)-4-chloro-5-cyano-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)N[P@](=O)(OC[C@H]1O[C@@](C#N)(n2ncc3c(N)ncnc32)[C@@H](Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H27ClN7O7P/c1-13(2)36-22(33)14(3)30-39(34,38-15-7-5-4-6-8-15)35-10-17-18(32)19(24)23(11-25,37-17)31-21-16(9-29-31)20(26)27-12-28-21/h4-9,12-14,17-19,32H,10H2,1-3H3,(H,30,34)(H2,26,27,28)/t14?,17-,18-,19+,23-,39+/m1/s1 |
| InChIKey | PJVOPUNTNBTZAI-WMVVLMOLSA-N |
| XLogP | 2.09 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.94 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|