C23H24Br2N5O7P — CID 158926865
(2R,4S,5R)-2-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile (PubChem CID 158926865) has the molecular formula C23H24Br2N5O7P and a molecular weight of 673.25 g/mol. Its IUPAC name is (2R,4S,5R)-2-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile.
| Compound Name | (2R,4S,5R)-2-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 158926865 |
| Molecular Formula | C23H24Br2N5O7P |
| Molecular Weight | 673.25 g/mol |
| Exact Mass | 670.98 |
| IUPAC Name | (2R,4S,5R)-2-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolane-2-carbonitrile |
| SMILES | CC(=O)[C@H](C)CP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(=O)[nH]c(N)nn23)C(Br)(Br)[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H24Br2N5O7P/c1-13(14(2)31)11-38(34,37-15-6-4-3-5-7-15)35-10-17-19(32)23(24,25)22(12-26,36-17)18-9-8-16-20(33)28-21(27)29-30(16)18/h3-9,13,17,19,32H,10-11H2,1-2H3,(H3,27,28,29,33)/t13-,17-,19+,22+,38?/m1/s1 |
| InChIKey | FEKNWNIEILEOMG-SWQRBIADSA-N |
| XLogP | 3.08 |
| TPSA | 182.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|