C24H27BrFN6O8P — CID 137200820
propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-bromo-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 137200820) has the molecular formula C24H27BrFN6O8P and a molecular weight of 657.39 g/mol. Its IUPAC name is propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-bromo-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-bromo-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137200820 |
| Molecular Formula | C24H27BrFN6O8P |
| Molecular Weight | 657.39 g/mol |
| Exact Mass | 656.08 |
| IUPAC Name | propyl (2S)-2-[[[(2R,4S,5R)-5-(2-amino-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-bromo-5-cyano-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(=O)[nH]c(N)nn23)[C@@](F)(Br)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H27BrFN6O8P/c1-3-11-37-21(35)14(2)31-41(36,40-15-7-5-4-6-8-15)38-12-17-19(33)24(25,26)23(13-27,39-17)18-10-9-16-20(34)29-22(28)30-32(16)18/h4-10,14,17,19,33H,3,11-12H2,1-2H3,(H,31,36)(H3,28,29,30,34)/t14-,17+,19?,23-,24+,41?/m0/s1 |
| InChIKey | CYAMOPFANFMLOZ-UGNVRMECSA-N |
| XLogP | 2.28 |
| TPSA | 203.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|