C22H25Br2N4O7P — CID 159259471
2-amino-7-[(2S,4S,5R)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 159259471) has the molecular formula C22H25Br2N4O7P and a molecular weight of 648.25 g/mol. Its IUPAC name is 2-amino-7-[(2S,4S,5R)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-amino-7-[(2S,4S,5R)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 159259471 |
| Molecular Formula | C22H25Br2N4O7P |
| Molecular Weight | 648.25 g/mol |
| Exact Mass | 645.98 |
| IUPAC Name | 2-amino-7-[(2S,4S,5R)-3,3-dibromo-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CC(=O)[C@H](C)CP(=O)(OC[C@H]1O[C@@H](c2ccc3c(=O)[nH]c(N)nn23)C(Br)(Br)[C@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H25Br2N4O7P/c1-12(13(2)29)11-36(32,35-14-6-4-3-5-7-14)33-10-17-18(30)22(23,24)19(34-17)15-8-9-16-20(31)26-21(25)27-28(15)16/h3-9,12,17-19,30H,10-11H2,1-2H3,(H3,25,26,27,31)/t12-,17-,18+,19+,36?/m1/s1 |
| InChIKey | NFSXNKHOZJSXBM-BPDRRWGUSA-N |
| XLogP | 3.41 |
| TPSA | 158.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|