C20H23BrFN2O8P — CID 159268190
1-[(2R,3S,5R)-3-bromo-3-fluoro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 159268190) has the molecular formula C20H23BrFN2O8P and a molecular weight of 549.29 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3-bromo-3-fluoro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5R)-3-bromo-3-fluoro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159268190 |
| Molecular Formula | C20H23BrFN2O8P |
| Molecular Weight | 549.29 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | 1-[(2R,3S,5R)-3-bromo-3-fluoro-4-hydroxy-5-[[[(2S)-2-methyl-3-oxobutyl]-phenoxyphosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(=O)[C@H](C)CP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](F)(Br)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H23BrFN2O8P/c1-12(13(2)25)11-33(29,32-14-6-4-3-5-7-14)30-10-15-17(27)20(21,22)18(31-15)24-9-8-16(26)23-19(24)28/h3-9,12,15,17-18,27H,10-11H2,1-2H3,(H,23,26,28)/t12-,15-,17?,18-,20-,33?/m1/s1 |
| InChIKey | VPXIPMSPIGCYAY-BHHKHZPTSA-N |
| XLogP | 2.37 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|