C20H25FN3O8P — CID 59585154
1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[phenoxy-[[(2S)-1,1,1,2-tetradeuterio-3-oxobutan-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 59585154) has the molecular formula C20H25FN3O8P and a molecular weight of 489.43 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[phenoxy-[[(2S)-1,1,1,2-tetradeuterio-3-oxobutan-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[phenoxy-[[(2S)-1,1,1,2-tetradeuterio-3-oxobutan-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59585154 |
| Molecular Formula | C20H25FN3O8P |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-3-methyl-5-[[phenoxy-[[(2S)-1,1,1,2-tetradeuterio-3-oxobutan-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [2H]C([2H])([2H])[C@]([2H])(N[P@](=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)Oc1ccccc1)C(C)=O |
| InChI | InChI=1S/C20H25FN3O8P/c1-12(13(2)25)23-33(29,32-14-7-5-4-6-8-14)30-11-15-17(27)20(3,21)18(31-15)24-10-9-16(26)22-19(24)28/h4-10,12,15,17-18,27H,11H2,1-3H3,(H,23,29)(H,22,26,28)/t12-,15+,17+,18+,20+,33-/m0/s1/i1D3,12D |
| InChIKey | DMJWZQVFZQNHCK-DNYRJHIJSA-N |
| XLogP | 1.29 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|