C27H32ClN4O8P — CID 58527326
propan-2-yl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-cyano-3,4-dihydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate (PubChem CID 58527326) has the molecular formula C27H32ClN4O8P and a molecular weight of 607.00 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-cyano-3,4-dihydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-cyano-3,4-dihydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 58527326 |
| Molecular Formula | C27H32ClN4O8P |
| Molecular Weight | 607.00 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | propan-2-yl (2S)-3-[(4-chlorophenoxy)-[[(2R,3R,4R,5R)-5-cyano-3,4-dihydroxy-4-methyl-5-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-yl]methoxy]phosphoryl]-2-methylpropanoate |
| SMILES | Cc1ncnn2c([C@]3(C#N)O[C@H](COP(=O)(C[C@@H](C)C(=O)OC(C)C)Oc4ccc(Cl)cc4)[C@@H](O)[C@@]3(C)O)ccc12 |
| InChI | InChI=1S/C27H32ClN4O8P/c1-16(2)38-25(34)17(3)13-41(36,40-20-8-6-19(28)7-9-20)37-12-22-24(33)26(5,35)27(14-29,39-22)23-11-10-21-18(4)30-15-31-32(21)23/h6-11,15-17,22,24,33,35H,12-13H2,1-5H3/t17-,22-,24-,26-,27+,41?/m1/s1 |
| InChIKey | DGHZKUBEHIXFPJ-GQWUHHGJSA-N |
| XLogP | 3.80 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|