C26H34ClN4O8P — CID 158348090
propan-2-yl (2S)-3-[[(2R,3R,4R,5S)-5-(1-aminopyrrolo[1,2-d][1,2,4]triazin-6-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]-2-methylpropanoate (PubChem CID 158348090) has the molecular formula C26H34ClN4O8P and a molecular weight of 597.01 g/mol. Its IUPAC name is propan-2-yl (2S)-3-[[(2R,3R,4R,5S)-5-(1-aminopyrrolo[1,2-d][1,2,4]triazin-6-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]-2-methylpropanoate.
| Compound Name | propan-2-yl (2S)-3-[[(2R,3R,4R,5S)-5-(1-aminopyrrolo[1,2-d][1,2,4]triazin-6-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]-2-methylpropanoate |
|---|---|
| PubChem CID | 158348090 |
| Molecular Formula | C26H34ClN4O8P |
| Molecular Weight | 597.01 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | propan-2-yl (2S)-3-[[(2R,3R,4R,5S)-5-(1-aminopyrrolo[1,2-d][1,2,4]triazin-6-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]-2-methylpropanoate |
| SMILES | CC(C)OC(=O)[C@H](C)CP(=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)nncn23)[C@](C)(O)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H34ClN4O8P/c1-15(2)37-24(33)16(3)13-40(35,39-18-8-6-17(27)7-9-18)36-12-20-22(32)25(4,34)26(5,38-20)21-11-10-19-23(28)30-29-14-31(19)21/h6-11,14-16,20,22,32,34H,12-13H2,1-5H3,(H2,28,30)/t16-,20-,22-,25-,26+,40?/m1/s1 |
| InChIKey | GRZFEUZEZGAYCO-ZTGGMCCGSA-N |
| XLogP | 3.57 |
| TPSA | 167.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.01 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|