C25H31N6O8P — CID 170219824
ethyl (2S)-1-[[(3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]pyrrolidine-2-carboxylate (PubChem CID 170219824) has the molecular formula C25H31N6O8P and a molecular weight of 574.53 g/mol. Its IUPAC name is ethyl (2S)-1-[[(3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[[(3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170219824 |
| Molecular Formula | C25H31N6O8P |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | ethyl (2S)-1-[[(3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN1P(=O)(OCC(C#N)(OC)[C@@H](O)[C@@H](O)c1ccc2c(N)ncnn12)Oc1ccccc1 |
| InChI | InChI=1S/C25H31N6O8P/c1-3-37-24(34)20-10-7-13-30(20)40(35,39-17-8-5-4-6-9-17)38-15-25(14-26,36-2)22(33)21(32)18-11-12-19-23(27)28-16-29-31(18)19/h4-6,8-9,11-12,16,20-22,32-33H,3,7,10,13,15H2,1-2H3,(H2,27,28,29)/t20-,21-,22-,25?,40?/m0/s1 |
| InChIKey | PWNFMIDUUCGVHF-LLSIGIATSA-N |
| XLogP | 1.85 |
| TPSA | 194.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|