C22H23N5O8P+ — CID 170232185
[(2R,3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-oxo-phenoxyphosphanium (PubChem CID 170232185) has the molecular formula C22H23N5O8P+ and a molecular weight of 516.43 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-oxo-phenoxyphosphanium.
| Compound Name | [(2R,3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 170232185 |
| Molecular Formula | C22H23N5O8P+ |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | [(2R,3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-oxo-phenoxyphosphanium |
| SMILES | CO[C@](C#N)(CO[P+](=O)Oc1ccccc1)[C@@H](OC(C)=O)[C@@H](OC(C)=O)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C22H23N5O8P/c1-14(28)33-19(17-9-10-18-21(24)25-13-26-27(17)18)20(34-15(2)29)22(11-23,31-3)12-32-36(30)35-16-7-5-4-6-8-16/h4-10,13,19-20H,12H2,1-3H3,(H2,24,25,26)/q+1/t19-,20-,22+/m0/s1 |
| InChIKey | SPAXBVDYXVJVHX-JAXLGGSGSA-N |
| XLogP | 2.51 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|