C18H26N6O7P+ — CID 170233336
[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-oxo-[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]phosphanium (PubChem CID 170233336) has the molecular formula C18H26N6O7P+ and a molecular weight of 469.42 g/mol. Its IUPAC name is [(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-oxo-[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]phosphanium.
| Compound Name | [(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-oxo-[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]phosphanium |
|---|---|
| PubChem CID | 170233336 |
| Molecular Formula | C18H26N6O7P+ |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-oxo-[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]phosphanium |
| SMILES | CCCOC(=O)[C@H](C)N[P+](=O)OC[C@@](C#N)(OC)[C@@H](O)[C@@H](O)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C18H26N6O7P/c1-4-7-30-17(27)11(2)23-32(28)31-9-18(8-19,29-3)15(26)14(25)12-5-6-13-16(20)21-10-22-24(12)13/h5-6,10-11,14-15,25-26H,4,7,9H2,1-3H3,(H,23,28)(H2,20,21,22)/q+1/t11-,14-,15-,18+/m0/s1 |
| InChIKey | SULZBNYIOJDJHH-FGVQXAILSA-N |
| XLogP | 0.22 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|