C28H39N6O8P — CID 170219656
2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]butanoate (PubChem CID 170219656) has the molecular formula C28H39N6O8P and a molecular weight of 618.63 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]butanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 170219656 |
| Molecular Formula | C28H39N6O8P |
| Molecular Weight | 618.63 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]butanoate |
| SMILES | CCC(CC)COC(=O)[C@H](CC)NP(=O)(OC[C@@](C#N)(OC)[C@@H](O)[C@@H](O)c1ccc2c(N)ncnn12)Oc1ccccc1 |
| InChI | InChI=1S/C28H39N6O8P/c1-5-19(6-2)15-40-27(37)21(7-3)33-43(38,42-20-11-9-8-10-12-20)41-17-28(16-29,39-4)25(36)24(35)22-13-14-23-26(30)31-18-32-34(22)23/h8-14,18-19,21,24-25,35-36H,5-7,15,17H2,1-4H3,(H,33,38)(H2,30,31,32)/t21-,24-,25-,28+,43?/m0/s1 |
| InChIKey | MQMGVPVDYSYFFA-ZOTLFWNISA-N |
| XLogP | 3.17 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|