C28H37N6O7P — CID 166807232
2-ethylbutyl (2S)-2-[[[(1R,2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166807232) has the molecular formula C28H37N6O7P and a molecular weight of 600.61 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(1R,2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(1R,2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166807232 |
| Molecular Formula | C28H37N6O7P |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(1R,2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-4,5-dihydroxycyclopentyl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@@H]1[C@@H](O)[C@@H](O)[C@@H](C#N)[C@@H]1c1ccc2c(N)ncnn12)Oc1ccccc1 |
| InChI | InChI=1S/C28H37N6O7P/c1-4-18(5-2)14-39-28(37)17(3)33-42(38,41-19-9-7-6-8-10-19)40-15-21-24(20(13-29)25(35)26(21)36)22-11-12-23-27(30)31-16-32-34(22)23/h6-12,16-18,20-21,24-26,35-36H,4-5,14-15H2,1-3H3,(H,33,38)(H2,30,31,32)/t17-,20-,21-,24-,25-,26+,42?/m0/s1 |
| InChIKey | DGRKCZJSGLPNCT-WMHJGDHDSA-N |
| XLogP | 3.05 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|