C30H37N6O11P — CID 170232182
oxan-4-yl (2S)-2-[[[(3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 170232182) has the molecular formula C30H37N6O11P and a molecular weight of 688.63 g/mol. Its IUPAC name is oxan-4-yl (2S)-2-[[[(3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | oxan-4-yl (2S)-2-[[[(3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170232182 |
| Molecular Formula | C30H37N6O11P |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | oxan-4-yl (2S)-2-[[[(3S,4S)-3,4-diacetyloxy-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-2-methoxybutoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(C#N)(COP(=O)(N[C@@H](C)C(=O)OC1CCOCC1)Oc1ccccc1)[C@@H](OC(C)=O)[C@@H](OC(C)=O)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C30H37N6O11P/c1-19(29(39)46-22-12-14-42-15-13-22)35-48(40,47-23-8-6-5-7-9-23)43-17-30(16-31,41-4)27(45-21(3)38)26(44-20(2)37)24-10-11-25-28(32)33-18-34-36(24)25/h5-11,18-19,22,26-27H,12-15,17H2,1-4H3,(H,35,40)(H2,32,33,34)/t19-,26-,27-,30?,48?/m0/s1 |
| InChIKey | WHJFWINMCOUMIF-SIFJOIQWSA-N |
| XLogP | 2.66 |
| TPSA | 224.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|