C31H42N5O10P — CID 166740391
cyclopropylmethyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-2-methyl-3,4-di(propanoyloxy)butoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 166740391) has the molecular formula C31H42N5O10P and a molecular weight of 675.68 g/mol. Its IUPAC name is cyclopropylmethyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-2-methyl-3,4-di(propanoyloxy)butoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclopropylmethyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-2-methyl-3,4-di(propanoyloxy)butoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166740391 |
| Molecular Formula | C31H42N5O10P |
| Molecular Weight | 675.68 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | cyclopropylmethyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxy-2-methyl-3,4-di(propanoyloxy)butoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(=O)O[C@@H](c1ccc2c(N)ncnn12)[C@H](OC(=O)CC)[C@@](C)(COP(=O)(N[C@@H](C)C(=O)OCC1CC1)Oc1ccccc1)OC |
| InChI | InChI=1S/C31H42N5O10P/c1-6-25(37)44-27(23-15-16-24-29(32)33-19-34-36(23)24)28(45-26(38)7-2)31(4,41-5)18-43-47(40,46-22-11-9-8-10-12-22)35-20(3)30(39)42-17-21-13-14-21/h8-12,15-16,19-21,27-28H,6-7,13-14,17-18H2,1-5H3,(H,35,40)(H2,32,33,34)/t20-,27-,28-,31+,47?/m0/s1 |
| InChIKey | SMBGSCAMKUCFEL-JGWMUGOLSA-N |
| XLogP | 4.17 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|