C32H42N5O10P — CID 174117396
cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-ethyl-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 174117396) has the molecular formula C32H42N5O10P and a molecular weight of 687.69 g/mol. Its IUPAC name is cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-ethyl-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-ethyl-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 174117396 |
| Molecular Formula | C32H42N5O10P |
| Molecular Weight | 687.69 g/mol |
| Exact Mass | 687.27 |
| IUPAC Name | cyclobutylmethyl (2S)-2-[[[(2R,3S,4S,5S)-3,4-diacetyloxy-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-ethyl-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC[C@]1(OC(C)=O)[C@@H](OC(C)=O)[C@H](c2ccc3c(N)ncnn23)O[C@]1(C)CO[P@](=O)(N[C@@H](C)C(=O)OCC1CCC1)Oc1ccccc1 |
| InChI | InChI=1S/C32H42N5O10P/c1-6-32(45-22(4)39)28(44-21(3)38)27(25-15-16-26-29(33)34-19-35-37(25)26)46-31(32,5)18-43-48(41,47-24-13-8-7-9-14-24)36-20(2)30(40)42-17-23-11-10-12-23/h7-9,13-16,19-20,23,27-28H,6,10-12,17-18H2,1-5H3,(H,36,41)(H2,33,34,35)/t20-,27-,28-,31+,32-,48+/m0/s1 |
| InChIKey | OAWBGIVCGIWCMU-KHTSTWKKSA-N |
| XLogP | 4.31 |
| TPSA | 191.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|