C30H41N6O8P — CID 170219921
2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]-3-cyclopropylpropanoate (PubChem CID 170219921) has the molecular formula C30H41N6O8P and a molecular weight of 644.67 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]-3-cyclopropylpropanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 170219921 |
| Molecular Formula | C30H41N6O8P |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.27 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-3,4-dihydroxy-2-methoxybutoxy]-phenoxyphosphoryl]amino]-3-cyclopropylpropanoate |
| SMILES | CCC(CC)COC(=O)[C@H](CC1CC1)NP(=O)(OC[C@@](C#N)(OC)[C@@H](O)[C@@H](O)c1ccc2c(N)ncnn12)Oc1ccccc1 |
| InChI | InChI=1S/C30H41N6O8P/c1-4-20(5-2)16-42-29(39)23(15-21-11-12-21)35-45(40,44-22-9-7-6-8-10-22)43-18-30(17-31,41-3)27(38)26(37)24-13-14-25-28(32)33-19-34-36(24)25/h6-10,13-14,19-21,23,26-27,37-38H,4-5,11-12,15-16,18H2,1-3H3,(H,35,40)(H2,32,33,34)/t23-,26-,27-,30+,45?/m0/s1 |
| InChIKey | AJGBFDYALZCTAN-KUNIKJGGSA-N |
| XLogP | 3.56 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|