C23H23N5O5 — CID 51034558
[(3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 51034558) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is [(3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 51034558 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [(3aR,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2,3a-trimethyl-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](COC(=O)c3ccccc3)OC(C#N)(c3ccc4c(N)ncnn34)[C@]2(C)O1 |
| InChI | InChI=1S/C23H23N5O5/c1-21(2)32-18-16(11-30-20(29)14-7-5-4-6-8-14)31-23(12-24,22(18,3)33-21)17-10-9-15-19(25)26-13-27-28(15)17/h4-10,13,16,18H,11H2,1-3H3,(H2,25,26,27)/t16-,18-,22-,23?/m1/s1 |
| InChIKey | PYXOMYLZRUWLLN-UQAALZJESA-N |
| XLogP | 2.20 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |