C26H23FN4O7 — CID 163501602
[(2R,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-benzoylperoxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 163501602) has the molecular formula C26H23FN4O7 and a molecular weight of 522.49 g/mol. Its IUPAC name is [(2R,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-benzoylperoxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-benzoylperoxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 163501602 |
| Molecular Formula | C26H23FN4O7 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [(2R,3R,4R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-benzoylperoxy-4-fluoro-5-hydroxy-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(F)[C@H](OOC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)OC1(O)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C26H23FN4O7/c1-25(27)21(37-38-24(33)17-10-6-3-7-11-17)19(14-35-23(32)16-8-4-2-5-9-16)36-26(25,34)20-13-12-18-22(28)29-15-30-31(18)20/h2-13,15,19,21,34H,14H2,1H3,(H2,28,29,30)/t19-,21-,25-,26?/m1/s1 |
| InChIKey | CVFPWRYHSROUOA-DKFDTRCMSA-N |
| XLogP | 2.60 |
| TPSA | 147.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|