C21H18FN5O6 — CID 138472805
[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate (PubChem CID 138472805) has the molecular formula C21H18FN5O6 and a molecular weight of 455.40 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate.
| Compound Name | [(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 138472805 |
| Molecular Formula | C21H18FN5O6 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-6-fluoro-2-methoxy-3a,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]methyl benzoate |
| SMILES | COC1O[C@@H]2[C@H](O1)[C@@](F)(COC(=O)c1ccccc1)O[C@@]2(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C21H18FN5O6/c1-29-19-31-15-16(32-19)21(22,10-30-18(28)12-5-3-2-4-6-12)33-20(15,9-23)14-8-7-13-17(24)25-11-26-27(13)14/h2-8,11,15-16,19H,10H2,1H3,(H2,24,25,26)/t15-,16+,19?,20+,21-/m1/s1 |
| InChIKey | DYVBDRJWQRJNFD-ZJEAFUIXSA-N |
| XLogP | 1.30 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |