C13H16N5O13P3 — CID 90125344
[[(1R,3R,4R,7S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90125344) has the molecular formula C13H16N5O13P3 and a molecular weight of 543.22 g/mol. Its IUPAC name is [[(1R,3R,4R,7S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,7S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90125344 |
| Molecular Formula | C13H16N5O13P3 |
| Molecular Weight | 543.22 g/mol |
| Exact Mass | 543.00 |
| IUPAC Name | [[(1R,3R,4R,7S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-cyano-7-hydroxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@@]2(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CO[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C13H16N5O13P3/c14-3-13(8-2-1-7-11(15)16-6-17-18(7)8)10-9(19)12(29-13,4-27-10)5-28-33(23,24)31-34(25,26)30-32(20,21)22/h1-2,6,9-10,19H,4-5H2,(H,23,24)(H,25,26)(H2,15,16,17)(H2,20,21,22)/t9-,10+,12+,13-/m0/s1 |
| InChIKey | DCECFAVYLGUFOB-YGNMPJRFSA-N |
| XLogP | -1.10 |
| TPSA | 278.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|