C12H15FN4O4 — CID 147770272
(3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-5-(hydroxymethyl)-3-methyloxolane-2,4-diol (PubChem CID 147770272) has the molecular formula C12H15FN4O4 and a molecular weight of 298.27 g/mol. Its IUPAC name is (3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-5-(hydroxymethyl)-3-methyloxolane-2,4-diol.
| Compound Name | (3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-5-(hydroxymethyl)-3-methyloxolane-2,4-diol |
|---|---|
| PubChem CID | 147770272 |
| Molecular Formula | C12H15FN4O4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (3R,4R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-5-(hydroxymethyl)-3-methyloxolane-2,4-diol |
| SMILES | C[C@@]1(F)[C@H](O)C(CO)OC1(O)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C12H15FN4O4/c1-11(13)9(19)7(4-18)21-12(11,20)8-3-2-6-10(14)15-5-16-17(6)8/h2-3,5,7,9,18-20H,4H2,1H3,(H2,14,15,16)/t7?,9-,11-,12?/m1/s1 |
| InChIKey | HFUFWPCXSGQAAQ-WUYMLZNFSA-N |
| XLogP | -1.06 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |