C13H14N8O3 — CID 74222476
(2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile (PubChem CID 74222476) has the molecular formula C13H14N8O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile.
| Compound Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile |
|---|---|
| PubChem CID | 74222476 |
| Molecular Formula | C13H14N8O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolane-2-carbonitrile |
| SMILES | C[C@@]1(N=[N+]=[N-])[C@H](O)[C@@H](CO)O[C@@]1(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C13H14N8O3/c1-12(19-20-16)10(23)8(4-22)24-13(12,5-14)9-3-2-7-11(15)17-6-18-21(7)9/h2-3,6,8,10,22-23H,4H2,1H3,(H2,15,17,18)/t8-,10-,12-,13+/m1/s1 |
| InChIKey | UNPNWNKDIYIQOC-DXLKZPDWSA-N |
| XLogP | -0.15 |
| TPSA | 178.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|