C18H23N5O5 — CID 166808306
[(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate (PubChem CID 166808306) has the molecular formula C18H23N5O5 and a molecular weight of 389.40 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate.
| Compound Name | [(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 166808306 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-cyano-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)O[C@@H]1[C@@H]([C@H](O[C@@]1(C#N)C2=CC=C3N2N=CN=C3N)CO)O |
| InChI | InChI=1S/C18H23N5O5/c1-3-10(4-2)17(26)27-15-14(25)12(7-24)28-18(15,8-19)13-6-5-11-16(20)21-9-22-23(11)13/h5-6,9-10,12,14-15,24-25H,3-4,7H2,1-2H3,(H2,20,21,22)/t12-,14-,15-,18+/m1/s1 |
| InChIKey | IODMBBFHPZIAOW-DRRHNWJESA-N |
| XLogP | 0.40 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | 623 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |