C21H27N5O6 — CID 171441600
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxolan-3-yl] 2,2-dimethylpropanoate (PubChem CID 171441600) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxolan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxolan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171441600 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-2-(hydroxymethyl)-4-(2-methylpropanoyloxy)oxolan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H]1[C@H](OC(=O)C(C)(C)C)[C@@H](CO)O[C@@]1(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C21H27N5O6/c1-11(2)18(28)31-16-15(30-19(29)20(3,4)5)13(8-27)32-21(16,9-22)14-7-6-12-17(23)24-10-25-26(12)14/h6-7,10-11,13,15-16,27H,8H2,1-5H3,(H2,23,24,25)/t13-,15-,16-,21+/m1/s1 |
| InChIKey | PGHTYFZRAXJNRW-KBCRCOCESA-N |
| XLogP | 0.95 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |