C25H33N5O7 — CID 163874980
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-amino-2-methylpropanoate (PubChem CID 163874980) has the molecular formula C25H33N5O7 and a molecular weight of 515.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-amino-2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 163874980 |
| Molecular Formula | C25H33N5O7 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-amino-2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@@H](OC(=O)C(C)C)[C@](C#N)(c2ccc3c(N)ccnn23)O[C@@H]1COC(=O)C(C)(C)N |
| InChI | InChI=1S/C25H33N5O7/c1-13(2)21(31)35-19-17(11-34-23(33)24(5,6)28)37-25(12-26,20(19)36-22(32)14(3)4)18-8-7-16-15(27)9-10-29-30(16)18/h7-10,13-14,17,19-20H,11,27-28H2,1-6H3/t17-,19-,20-,25+/m1/s1 |
| InChIKey | VMVYEOHYNRMYJW-ILDDTBCLSA-N |
| XLogP | 1.45 |
| TPSA | 181.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|