C19H21N5O5 — CID 167006354
[(1S,3R,5R,6S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl] 2-methylpropanoate (PubChem CID 167006354) has the molecular formula C19H21N5O5 and a molecular weight of 399.41 g/mol. Its IUPAC name is [(1S,3R,5R,6S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl] 2-methylpropanoate.
| Compound Name | [(1S,3R,5R,6S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 167006354 |
| Molecular Formula | C19H21N5O5 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [(1S,3R,5R,6S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-8,8-dimethyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1[C@H]2O[C@@](C#N)(c3ccc4c(N)ncnn34)[C@@H]3OC(C)(C)O[C@]123 |
| InChI | InChI=1S/C19H21N5O5/c1-9(2)15(25)26-12-13-19(12)16(28-17(3,4)29-19)18(7-20,27-13)11-6-5-10-14(21)22-8-23-24(10)11/h5-6,8-9,12-13,16H,1-4H3,(H2,21,22,23)/t12?,13-,16+,18+,19-/m1/s1 |
| InChIKey | SIMPDPLGDGLVMD-VHPZVFBOSA-N |
| XLogP | 0.90 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |