C11H15N5O2 — CID 118409928
[(2S,3S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolan-2-yl]methanol (PubChem CID 118409928) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is [(2S,3S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 118409928 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [(2S,3S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-methyloxolan-2-yl]methanol |
| SMILES | C[C@H]1C[C@H](c2cnc3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C11H15N5O2/c1-6-2-8(18-9(6)4-17)7-3-13-11-10(12)14-5-15-16(7)11/h3,5-6,8-9,17H,2,4H2,1H3,(H2,12,14,15)/t6-,8+,9+/m0/s1 |
| InChIKey | OVOVIKCAHAYVMI-NBEYISGCSA-N |
| XLogP | 0.16 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |