C12H11N5O3 — CID 131965860
(1R,3R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-1-ethynyl-2-oxabicyclo[3.1.0]hexane-5,6-diol (PubChem CID 131965860) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is (1R,3R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-1-ethynyl-2-oxabicyclo[3.1.0]hexane-5,6-diol.
| Compound Name | (1R,3R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-1-ethynyl-2-oxabicyclo[3.1.0]hexane-5,6-diol |
|---|---|
| PubChem CID | 131965860 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (1R,3R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-1-ethynyl-2-oxabicyclo[3.1.0]hexane-5,6-diol |
| SMILES | C#C[C@]12O[C@@H](c3cnc4c(N)ncnn34)C[C@@]1(O)C2O |
| InChI | InChI=1S/C12H11N5O3/c1-2-12-10(18)11(12,19)3-7(20-12)6-4-14-9-8(13)15-5-16-17(6)9/h1,4-5,7,10,18-19H,3H2,(H2,13,15,16)/t7-,10?,11-,12-/m1/s1 |
| InChIKey | CAJWNWMMZAGKDP-ONGJSYAZSA-N |
| XLogP | -1.35 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|