C11H10IN7O3 — CID 174151043
(1R,3R,5R)-3-(4-amino-5-iodopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-azido-2-oxabicyclo[3.1.0]hexane-5,6-diol (PubChem CID 174151043) has the molecular formula C11H10IN7O3 and a molecular weight of 415.15 g/mol. Its IUPAC name is (1R,3R,5R)-3-(4-amino-5-iodopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-azido-2-oxabicyclo[3.1.0]hexane-5,6-diol.
| Compound Name | (1R,3R,5R)-3-(4-amino-5-iodopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-azido-2-oxabicyclo[3.1.0]hexane-5,6-diol |
|---|---|
| PubChem CID | 174151043 |
| Molecular Formula | C11H10IN7O3 |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | (1R,3R,5R)-3-(4-amino-5-iodopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-azido-2-oxabicyclo[3.1.0]hexane-5,6-diol |
| SMILES | [N-]=[N+]=N[C@]12O[C@@H](c3cc(I)c4c(N)ncnn34)C[C@@]1(O)C2O |
| InChI | InChI=1S/C11H10IN7O3/c12-4-1-5(19-7(4)8(13)15-3-16-19)6-2-10(21)9(20)11(10,22-6)17-18-14/h1,3,6,9,20-21H,2H2,(H2,13,15,16)/t6-,9?,10-,11-/m1/s1 |
| InChIKey | FNWOWJCDNRGDBA-FCPLBOMLSA-N |
| XLogP | 0.49 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|