C13H14N10O3 — CID 71229232
(2S,3S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 71229232) has the molecular formula C13H14N10O3 and a molecular weight of 358.32 g/mol. Its IUPAC name is (2S,3S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 71229232 |
| Molecular Formula | C13H14N10O3 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (2S,3S,5S)-2-[4-amino-5-(2H-triazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-5-azido-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@@]1(CO)C[C@H](O)[C@H](c2cc(-c3cn[nH]n3)c3c(N)ncnn23)O1 |
| InChI | InChI=1S/C13H14N10O3/c14-12-10-6(7-3-17-22-19-7)1-8(23(10)18-5-16-12)11-9(25)2-13(4-24,26-11)20-21-15/h1,3,5,9,11,24-25H,2,4H2,(H2,14,16,18)(H,17,19,22)/t9-,11-,13-/m0/s1 |
| InChIKey | FVPLCQLFEKLKHF-GAFUQQFSSA-N |
| XLogP | -0.08 |
| TPSA | 196.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|