C13H13N7O3 — CID 89391419
(2S,3S,5S)-2-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-azido-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 89391419) has the molecular formula C13H13N7O3 and a molecular weight of 315.29 g/mol. Its IUPAC name is (2S,3S,5S)-2-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-azido-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3S,5S)-2-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-azido-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 89391419 |
| Molecular Formula | C13H13N7O3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2S,3S,5S)-2-(4-amino-5-ethynylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-azido-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#Cc1cc([C@@H]2O[C@@](CO)(N=[N+]=[N-])C[C@@H]2O)n2ncnc(N)c12 |
| InChI | InChI=1S/C13H13N7O3/c1-2-7-3-8(20-10(7)12(14)16-6-17-20)11-9(22)4-13(5-21,23-11)18-19-15/h1,3,6,9,11,21-22H,4-5H2,(H2,14,16,17)/t9-,11-,13-/m0/s1 |
| InChIKey | MRIRYEPJFJXCOS-GAFUQQFSSA-N |
| XLogP | 0.11 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|