C19H28N4O2Si — CID 59185434
[(2S,3S,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol (PubChem CID 59185434) has the molecular formula C19H28N4O2Si and a molecular weight of 372.55 g/mol. Its IUPAC name is [(2S,3S,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185434 |
| Molecular Formula | C19H28N4O2Si |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [(2S,3S,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,4-trimethyloxolan-2-yl]methanol |
| SMILES | C[C@@H]1[C@@H](CO)O[C@@H](c2cc(C#C[Si](C)(C)C)c3c(N)ncnn23)C1(C)C |
| InChI | InChI=1S/C19H28N4O2Si/c1-12-15(10-24)25-17(19(12,2)3)14-9-13(7-8-26(4,5)6)16-18(20)21-11-22-23(14)16/h9,11-12,15,17,24H,10H2,1-6H3,(H2,20,21,22)/t12-,15-,17+/m1/s1 |
| InChIKey | SWZWRMSPVVLEIP-VMGRFDJRSA-N |
| XLogP | 2.63 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|