C14H18N4O4 — CID 25000918
(2S,3R,4R,5R)-2-(4-amino-5-ethenylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 25000918) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(4-amino-5-ethenylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-(4-amino-5-ethenylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 25000918 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2S,3R,4R,5R)-2-(4-amino-5-ethenylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | C=Cc1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@@]2(C)O)n2ncnc(N)c12 |
| InChI | InChI=1S/C14H18N4O4/c1-3-7-4-8(18-10(7)13(15)16-6-17-18)12-14(2,21)11(20)9(5-19)22-12/h3-4,6,9,11-12,19-21H,1,5H2,2H3,(H2,15,16,17)/t9-,11-,12+,14-/m1/s1 |
| InChIKey | XGPMCTUPRBLBHI-SGESHTKJSA-N |
| XLogP | -0.50 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |