C11H13BrN4Si — CID 140823285
7-bromo-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 140823285) has the molecular formula C11H13BrN4Si and a molecular weight of 309.24 g/mol. Its IUPAC name is 7-bromo-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-bromo-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 140823285 |
| Molecular Formula | C11H13BrN4Si |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 7-bromo-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | C[Si](C)(C)C#Cc1cc(Br)n2ncnc(N)c12 |
| InChI | InChI=1S/C11H13BrN4Si/c1-17(2,3)5-4-8-6-9(12)16-10(8)11(13)14-7-15-16/h6-7H,1-3H3,(H2,13,14,15) |
| InChIKey | FGHSKYDNMSQRAZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|