C13H12Br2ClFN8 — CID 161436110
7-bromo-5-chloropyrrolo[2,1-f][1,2,4]triazin-4-amine;7-bromopyrrolo[2,1-f][1,2,4]triazin-4-amine;deuterio(fluoro)methane (PubChem CID 161436110) has the molecular formula C13H12Br2ClFN8 and a molecular weight of 495.56 g/mol. Its IUPAC name is 7-bromo-5-chloropyrrolo[2,1-f][1,2,4]triazin-4-amine;7-bromopyrrolo[2,1-f][1,2,4]triazin-4-amine;deuterio(fluoro)methane.
| Compound Name | 7-bromo-5-chloropyrrolo[2,1-f][1,2,4]triazin-4-amine;7-bromopyrrolo[2,1-f][1,2,4]triazin-4-amine;deuterio(fluoro)methane |
|---|---|
| PubChem CID | 161436110 |
| Molecular Formula | C13H12Br2ClFN8 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | 7-bromo-5-chloropyrrolo[2,1-f][1,2,4]triazin-4-amine;7-bromopyrrolo[2,1-f][1,2,4]triazin-4-amine;deuterio(fluoro)methane |
| SMILES | Nc1ncnn2c(Br)cc(Cl)c12.Nc1ncnn2c(Br)ccc12.[2H]CF |
| InChI | InChI=1S/C6H4BrClN4.C6H5BrN4.CH3F/c7-4-1-3(8)5-6(9)10-2-11-12(4)5;7-5-2-1-4-6(8)9-3-10-11(4)5;1-2/h1-2H,(H2,9,10,11);1-3H,(H2,8,9,10);1H3/i;;1D |
| InChIKey | VYQZPYAOYPBQGE-PRQZKWGPSA-N |
| XLogP | 3.39 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |