C6H5IN4 — CID 90176299
7-iodopyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 90176299) has the molecular formula C6H5IN4 and a molecular weight of 260.04 g/mol. Its IUPAC name is 7-iodopyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-iodopyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 90176299 |
| Molecular Formula | C6H5IN4 |
| Molecular Weight | 260.04 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 7-iodopyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(I)ccc12 |
| InChI | InChI=1S/C6H5IN4/c7-5-2-1-4-6(8)9-3-10-11(4)5/h1-3H,(H2,8,9,10) |
| InChIKey | ZEBGLCLVPCOXIV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.04 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|