C13H18N4O2 — CID 145074462
acetylene;4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutan-1-ol (PubChem CID 145074462) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is acetylene;4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutan-1-ol.
| Compound Name | acetylene;4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutan-1-ol |
|---|---|
| PubChem CID | 145074462 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | acetylene;4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutan-1-ol |
| SMILES | C#C.COC(CO)CCc1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C11H16N4O2.C2H2/c1-17-9(6-16)4-2-8-3-5-10-11(12)13-7-14-15(8)10;1-2/h3,5,7,9,16H,2,4,6H2,1H3,(H2,12,13,14);1-2H |
| InChIKey | OTXZGFHKPOLXIF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|