C16H25ClN4O3 — CID 169174496
[4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutyl] butanoate;chloromethane (PubChem CID 169174496) has the molecular formula C16H25ClN4O3 and a molecular weight of 356.85 g/mol. Its IUPAC name is [4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutyl] butanoate;chloromethane.
| Compound Name | [4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutyl] butanoate;chloromethane |
|---|---|
| PubChem CID | 169174496 |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-methoxybutyl] butanoate;chloromethane |
| SMILES | CCCC(=O)OCC(CCc1ccc2c(N)ncnn12)OC.CCl |
| InChI | InChI=1S/C15H22N4O3.CH3Cl/c1-3-4-14(20)22-9-12(21-2)7-5-11-6-8-13-15(16)17-10-18-19(11)13;1-2/h6,8,10,12H,3-5,7,9H2,1-2H3,(H2,16,17,18);1H3 |
| InChIKey | HZGAPVNREPZGFY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|