C23H34N4O10 — CID 176922661
[(1S,2S)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methoxy-1,4-bis(propan-2-yloxycarbonyloxy)butan-2-yl] propan-2-yl carbonate (PubChem CID 176922661) has the molecular formula C23H34N4O10 and a molecular weight of 526.54 g/mol. Its IUPAC name is [(1S,2S)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methoxy-1,4-bis(propan-2-yloxycarbonyloxy)butan-2-yl] propan-2-yl carbonate.
| Compound Name | [(1S,2S)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methoxy-1,4-bis(propan-2-yloxycarbonyloxy)butan-2-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 176922661 |
| Molecular Formula | C23H34N4O10 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | [(1S,2S)-1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-methoxy-1,4-bis(propan-2-yloxycarbonyloxy)butan-2-yl] propan-2-yl carbonate |
| SMILES | COC(COC(=O)OC(C)C)[C@@H](OC(=O)OC(C)C)[C@@H](OC(=O)OC(C)C)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C23H34N4O10/c1-12(2)33-21(28)32-10-17(31-7)19(37-23(30)35-14(5)6)18(36-22(29)34-13(3)4)15-8-9-16-20(24)25-11-26-27(15)16/h8-9,11-14,17-19H,10H2,1-7H3,(H2,24,25,26)/t17?,18-,19+/m0/s1 |
| InChIKey | LWFQUVPZDUXNII-JLMCIHFGSA-N |
| XLogP | 3.42 |
| TPSA | 172.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|