C8H9ClN4O — CID 143458596
1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-chloroethanol (PubChem CID 143458596) has the molecular formula C8H9ClN4O and a molecular weight of 212.64 g/mol. Its IUPAC name is 1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-chloroethanol.
| Compound Name | 1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-chloroethanol |
|---|---|
| PubChem CID | 143458596 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 1-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-chloroethanol |
| SMILES | Nc1ncnn2c(C(O)CCl)ccc12 |
| InChI | InChI=1S/C8H9ClN4O/c9-3-7(14)5-1-2-6-8(10)11-4-12-13(5)6/h1-2,4,7,14H,3H2,(H2,10,11,12) |
| InChIKey | RCSWXEBZZCUOHU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|