C11H20N4 — CID 145368095
ethane;7-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 145368095) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is ethane;7-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | ethane;7-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 145368095 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | ethane;7-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC.CC.Cc1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C7H8N4.2C2H6/c1-5-2-3-6-7(8)9-4-10-11(5)6;2*1-2/h2-4H,1H3,(H2,8,9,10);2*1-2H3 |
| InChIKey | DKDKYMOPHCTMFH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |